ChemNet > CAS > 703-59-3 Homophthalic anhydride
703-59-3 Homophthalic anhydride
| Naam product |
Homophthalic anhydride |
| Engelse naam |
Homophthalic anhydride; 1,3-Isochromandione; benzoglutaric anhydride; 1H-isochromene-1,3(4H)-dione; o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
| MF |
C9H6O3 |
| Molecuulgewicht |
162.1421 |
| InChI |
InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
| CAS-nummer |
703-59-3 |
| EINECS |
211-873-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.347g/cm3 |
| Smeltpunt |
140-144℃ |
| Kookpunt |
324.5°C at 760 mmHg |
| Brekingsindex |
1.584 |
| Vlampunt |
159°C |
| Dampdruk |
0.000244mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
