704-38-1 Bis(2-thienyl) ketone
Naam product |
Bis(2-thienyl) ketone |
Engelse naam |
Bis(2-thienyl) ketone; Di-2-thienyl ketone; Bis(2-thienyl)ketone~Di-2-thienyl ketone; dithiophen-2-ylmethanone |
MF |
C9H6OS2 |
Molecuulgewicht |
194.2733 |
InChI |
InChI=1/C9H6OS2/c10-9(7-3-1-5-11-7)8-4-2-6-12-8/h1-6H |
CAS-nummer |
704-38-1 |
Moleculaire Structuur |
|
Dichtheid |
1.326g/cm3 |
Smeltpunt |
89-91℃ |
Kookpunt |
323°C at 760 mmHg |
Brekingsindex |
1.64 |
Vlampunt |
149.1°C |
Dampdruk |
0.00027mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|