ChemNet > CAS > 7073-94-1 1-Bromo-2-isopropylbenzene
7073-94-1 1-Bromo-2-isopropylbenzene
Naam product |
1-Bromo-2-isopropylbenzene |
Engelse naam |
1-Bromo-2-isopropylbenzene; 2-Bromocumene; 2-Isopropylbromobenzene; 1-bromo-2-(propan-2-yl)benzene; 1-Bromo-2-isopropyl benzene; 2-bromo isopropyl benzene; 2-Bromoisopropylbenzene; 1-Bromo-2-(1-Methylethyl)Benzene |
MF |
C9H11Br |
Molecuulgewicht |
199.0876 |
InChI |
InChI=1/C9H11Br/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,1-2H3 |
CAS-nummer |
7073-94-1 |
EINECS |
230-370-0 |
Moleculaire Structuur |
|
Dichtheid |
1.278g/cm3 |
Kookpunt |
210.2°C at 760 mmHg |
Brekingsindex |
1.53 |
Vlampunt |
81.6°C |
Dampdruk |
0.282mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|