ChemNet > CAS > 709-09-1 1,2-Dimethoxy-4-nitrobenzene
709-09-1 1,2-Dimethoxy-4-nitrobenzene
Naam product |
1,2-Dimethoxy-4-nitrobenzene |
Engelse naam |
1,2-Dimethoxy-4-nitrobenzene; 4-Nitroveratrole; 1,2-dimethoxy-4-nitro-benzen; 3,4-Dimethoxynitrobenzene; 4-Nitrcveratrole; 4-NITRO-1,2-DIMETHOXYBENZENE; Benzene, 1,2-dimethoxy-4-nitro-; 3,4-dimethoxy-nitrobenzene |
MF |
C8H7IO2 |
Molecuulgewicht |
262.0444 |
InChI |
InChI=1/C8H7IO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) |
CAS-nummer |
709-09-1 |
EINECS |
211-906-2 |
Moleculaire Structuur |
|
Dichtheid |
1.867g/cm3 |
Smeltpunt |
95-98℃ |
Kookpunt |
355.2°C at 760 mmHg |
Brekingsindex |
1.645 |
Vlampunt |
168.6°C |
Dampdruk |
1.16E-05mmHg at 25°C |
Gevaarsymbolen |
Xn,Xi:;
|
Risico-codes |
22:;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|