ChemNet > CAS > 71022-43-0 3,5-Dinitrobenzyl alcohol
71022-43-0 3,5-Dinitrobenzyl alcohol
| Naam product |
3,5-Dinitrobenzyl alcohol |
| Engelse naam |
3,5-Dinitrobenzyl alcohol; (3,5-dinitrophenyl)methanol |
| MF |
C7H6N2O5 |
| Molecuulgewicht |
198.1329 |
| InChI |
InChI=1/C7H6N2O5/c10-4-5-1-6(8(11)12)3-7(2-5)9(13)14/h1-3,10H,4H2 |
| CAS-nummer |
71022-43-0 |
| EINECS |
275-131-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.56g/cm3 |
| Smeltpunt |
88-92℃ |
| Kookpunt |
404.2°C at 760 mmHg |
| Brekingsindex |
1.641 |
| Vlampunt |
183.7°C |
| Dampdruk |
2.94E-07mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
