ChemNet > CAS > 7145-82-6 2,4,6-Trichloroiodobenzene
7145-82-6 2,4,6-Trichloroiodobenzene
Naam product |
2,4,6-Trichloroiodobenzene |
Engelse naam |
2,4,6-Trichloroiodobenzene; 2,4,5-Trichloroiodobenzene; 1-Iodo-2,4,5-trichlorobenzene; 1,2,4-trichloro-5-iodobenzene |
MF |
C6H2Cl3I |
Molecuulgewicht |
307.3435 |
InChI |
InChI=1/C6H2Cl3I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
CAS-nummer |
7145-82-6 |
Moleculaire Structuur |
|
Dichtheid |
2.085g/cm3 |
Smeltpunt |
56-58℃ |
Kookpunt |
292.8°C at 760 mmHg |
Brekingsindex |
1.651 |
Vlampunt |
130.9°C |
Dampdruk |
0.00314mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|