ChemNet > CAS > 71463-55-3 1-(2,4-dichloorfenyl)-1-cyclopropylcyanide
71463-55-3 1-(2,4-dichloorfenyl)-1-cyclopropylcyanide
| Naam product |
1-(2,4-dichloorfenyl)-1-cyclopropylcyanide |
| Synoniemen |
1-(2,4-dichloorfenyl)cyclopropaancarbonitril |
| Engelse naam |
1-(2,4-Dichlorophenyl)-1-cyclopropyl cyanide;1-(2,4-Dichlorophenyl)cyclopropanecarbonitrile |
| MF |
C10H7Cl2N |
| Molecuulgewicht |
212.0753 |
| InChI |
InChI=1/C10H7Cl2N/c11-7-1-2-8(9(12)5-7)10(6-13)3-4-10/h1-2,5H,3-4H2 |
| CAS-nummer |
71463-55-3 |
| EINECS |
275-494-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.38g/cm3 |
| Smeltpunt |
81-85℃ |
| Kookpunt |
337.4°C at 760 mmHg |
| Brekingsindex |
1.604 |
| Vlampunt |
149.5°C |
| Dampdruk |
0.000105mmHg at 25°C |
| Gevaarsymbolen |
T:Toxic;
|
| Risico-codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|