ChemNet > CAS > 7152-24-1 2-(Methylmercapto)benzimidazole
7152-24-1 2-(Methylmercapto)benzimidazole
Naam product |
2-(Methylmercapto)benzimidazole |
Engelse naam |
2-(Methylmercapto)benzimidazole; 2-(Methylthio)benzimidazole; 2-(methylsulfanyl)-1H-benzimidazole |
MF |
C8H8N2S |
Molecuulgewicht |
164.2275 |
InChI |
InChI=1/C8H8N2S/c1-11-8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3,(H,9,10) |
CAS-nummer |
7152-24-1 |
EINECS |
230-494-5 |
Moleculaire Structuur |
|
Dichtheid |
1.29g/cm3 |
Smeltpunt |
202-205℃ |
Kookpunt |
347.2°C at 760 mmHg |
Brekingsindex |
1.691 |
Vlampunt |
163.8°C |
Dampdruk |
5.48E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|