ChemNet > CAS > 719-54-0 10-Methyl-9(10H)-acridone
719-54-0 10-Methyl-9(10H)-acridone
Naam product |
10-Methyl-9(10H)-acridone |
Engelse naam |
10-Methyl-9(10H)-acridone; 10-methylacridin-9(10H)-one; Methylacridone; N-Methylacridone |
MF |
C14H11NO |
Molecuulgewicht |
209.2432 |
InChI |
InChI=1/C14H11NO/c1-15-12-8-4-2-6-10(12)14(16)11-7-3-5-9-13(11)15/h2-9H,1H3 |
CAS-nummer |
719-54-0 |
EINECS |
211-948-1 |
Moleculaire Structuur |
|
Dichtheid |
1.205g/cm3 |
Smeltpunt |
204-207℃ |
Kookpunt |
361.3°C at 760 mmHg |
Brekingsindex |
1.635 |
Vlampunt |
146.2°C |
Dampdruk |
2.09E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|