ChemNet > CAS > 72065-23-7 N-Acryloylsarcosine methyl ester
72065-23-7 N-Acryloylsarcosine methyl ester
Naam product |
N-Acryloylsarcosine methyl ester |
Engelse naam |
N-Acryloylsarcosine methyl ester;methyl N-acryloyl-N-methylglycinate |
MF |
C7H11NO3 |
Molecuulgewicht |
157.1671 |
InChI |
InChI=1/C7H11NO3/c1-4-6(9)8(2)5-7(10)11-3/h4H,1,5H2,2-3H3 |
CAS-nummer |
72065-23-7 |
Moleculaire Structuur |
|
Dichtheid |
1.068g/cm3 |
Kookpunt |
276.3°C at 760 mmHg |
Brekingsindex |
1.452 |
Vlampunt |
120.9°C |
Dampdruk |
0.00485mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|