723-89-7 1-phenylisatin
Naam product |
1-phenylisatin |
Engelse naam |
1-phenylisatin;1H-Indole-2,3-dione, 1-phenyl- (9CI); 1-Phenyl-1H-indole-2,3-dione; 1-Phenyl-indole-2,3-dione; 1-Phenylisatin; 5-21-10-00247 (Beilstein Handbook Reference); BRN 0164531; NSC 100013; Indole-2,3-dione, 1-phenyl- |
MF |
C14H9NO2 |
Molecuulgewicht |
223.2268 |
InChI |
InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
CAS-nummer |
723-89-7 |
Moleculaire Structuur |
|
Dichtheid |
1.338g/cm3 |
Smeltpunt |
138-140℃ |
Kookpunt |
388.8°C at 760 mmHg |
Brekingsindex |
1.667 |
Vlampunt |
182.6°C |
Dampdruk |
2.99E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|