ChemNet > CAS > 72571-06-3 5-(4-bromophenyl)-1,3-oxazole
72571-06-3 5-(4-bromophenyl)-1,3-oxazole
| Naam product |
5-(4-bromophenyl)-1,3-oxazole |
| Engelse naam |
5-(4-bromophenyl)-1,3-oxazole; |
| MF |
C9H6BrNO |
| Molecuulgewicht |
224.054 |
| InChI |
InChI=1/C9H6BrNO/c10-8-3-1-7(2-4-8)9-5-11-6-12-9/h1-6H |
| CAS-nummer |
72571-06-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.524g/cm3 |
| Smeltpunt |
78℃ |
| Kookpunt |
315.8°C at 760 mmHg |
| Brekingsindex |
1.58 |
| Vlampunt |
144.8°C |
| Dampdruk |
0.000794mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
