ChemNet > CAS > 7297-95-2 trimesitylborane
7297-95-2 trimesitylborane
Naam product |
trimesitylborane |
Engelse naam |
trimesitylborane; |
MF |
C27H33B |
Molecuulgewicht |
368.3619 |
InChI |
InChI=1/C27H33B/c1-16-10-19(4)25(20(5)11-16)28(26-21(6)12-17(2)13-22(26)7)27-23(8)14-18(3)15-24(27)9/h10-15H,1-9H3 |
CAS-nummer |
7297-95-2 |
Moleculaire Structuur |
|
Dichtheid |
0.98g/cm3 |
Smeltpunt |
193-195℃ |
Kookpunt |
477.6°C at 760 mmHg |
Brekingsindex |
1.561 |
Vlampunt |
242.6°C |
Dampdruk |
7.99E-09mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|