733-07-3 dimesitylmethane
Naam product |
dimesitylmethane |
Engelse naam |
dimesitylmethane; Bis(2,4,6-trimethylphenyl)methane~2,2-Methylenedimesitylene; 1,1-Methylenebis-(2,4,6-trimethylbenzene); 1,1'-methanediylbis(2,4,6-trimethylbenzene) |
MF |
C19H24 |
Molecuulgewicht |
252.3939 |
InChI |
InChI=1/C19H24/c1-12-7-14(3)18(15(4)8-12)11-19-16(5)9-13(2)10-17(19)6/h7-10H,11H2,1-6H3 |
CAS-nummer |
733-07-3 |
EINECS |
211-991-6 |
Moleculaire Structuur |
|
Dichtheid |
0.947g/cm3 |
Smeltpunt |
132-135℃ |
Kookpunt |
370.7°C at 760 mmHg |
Brekingsindex |
1.547 |
Vlampunt |
192.8°C |
Dampdruk |
2.31E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|