733-07-3 dimesitylmethane
  
   | 
  
    | Naam product | dimesitylmethane |  
    | Engelse naam | dimesitylmethane; Bis(2,4,6-trimethylphenyl)methane~2,2-Methylenedimesitylene; 1,1-Methylenebis-(2,4,6-trimethylbenzene); 1,1'-methanediylbis(2,4,6-trimethylbenzene) |  
    | MF | C19H24 |  
    | Molecuulgewicht | 252.3939 |  
    | InChI | InChI=1/C19H24/c1-12-7-14(3)18(15(4)8-12)11-19-16(5)9-13(2)10-17(19)6/h7-10H,11H2,1-6H3 |  
    | CAS-nummer | 733-07-3 |  
    | EINECS | 211-991-6 |  
    | Moleculaire Structuur |   |  
    | Dichtheid | 0.947g/cm3 |  
    | Smeltpunt | 132-135℃ |  
    | Kookpunt | 370.7°C at 760 mmHg |  
    | Brekingsindex | 1.547 |  
    | Vlampunt | 192.8°C |  
    | Dampdruk | 2.31E-05mmHg at 25°C |  
    | Veiligheid Omschrijving | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.;
 
 |  |