ChemNet > CAS > 74896-66-5 methyl 3,5-dibromo-4-methylbenzoate
74896-66-5 methyl 3,5-dibromo-4-methylbenzoate
Naam product |
methyl 3,5-dibromo-4-methylbenzoate |
Engelse naam |
methyl 3,5-dibromo-4-methylbenzoate; 3,5-Dibromo-4-methylbenzoic acid methyl ester; 3,5-Dibromo-p-toluic acid methyl ester (COOCH3=1) |
MF |
C9H8Br2O2 |
Molecuulgewicht |
307.9666 |
InChI |
InChI=1/C9H8Br2O2/c1-5-7(10)3-6(4-8(5)11)9(12)13-2/h3-4H,1-2H3 |
CAS-nummer |
74896-66-5 |
Moleculaire Structuur |
|
Dichtheid |
1.75g/cm3 |
Kookpunt |
314°C at 760 mmHg |
Brekingsindex |
1.575 |
Vlampunt |
143.7°C |
Dampdruk |
0.000478mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|