ChemNet > CAS > 76141-89-4 1-(4-fluorobenzyl)-1,4-diazepane
76141-89-4 1-(4-fluorobenzyl)-1,4-diazepane
| Naam product |
1-(4-fluorobenzyl)-1,4-diazepane |
| Engelse naam |
1-(4-fluorobenzyl)-1,4-diazepane; |
| MF |
C12H17FN2 |
| Molecuulgewicht |
208.2752 |
| InChI |
InChI=1/C12H17FN2/c13-12-4-2-11(3-5-12)10-15-8-1-6-14-7-9-15/h2-5,14H,1,6-10H2 |
| CAS-nummer |
76141-89-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.074g/cm3 |
| Kookpunt |
291.7°C at 760 mmHg |
| Brekingsindex |
1.522 |
| Vlampunt |
130.2°C |
| Dampdruk |
0.00192mmHg at 25°C |
| Gevaarsymbolen |
 C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
