763-32-6 3-Methyl-3-buten-1-ol
Naam product |
3-Methyl-3-buten-1-ol |
Engelse naam |
3-Methyl-3-buten-1-ol;Isobutenylcarbinol; 2-Methyl-1-buten-4-ol; 3-Isopentenyl alcohol; Isoprenol; Isopropenylethyl alcohol; Methallylcarbinol; NSC 122673; 3-Buten-1-ol, 3-methyl-; 3-Methylbut-3-en-1-ol |
MF |
C5H10O |
Molecuulgewicht |
86.1323 |
InChI |
InChI=1/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3 |
CAS-nummer |
763-32-6 |
EINECS |
212-110-8 |
Moleculaire Structuur |
|
Dichtheid |
0.832g/cm3 |
Kookpunt |
114.2°C at 760 mmHg |
Brekingsindex |
1.422 |
Vlampunt |
40.1°C |
Dampdruk |
10.2mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R10:Flammable.;
R36:Irritating to eyes.;
|
Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
S24:Avoid contact with skin.;
|
|