ChemNet > CAS > 76649-14-4 3-Octen-2-ol
76649-14-4 3-Octen-2-ol
| Naam product |
3-Octen-2-ol |
| Engelse naam |
3-Octen-2-ol;FEMA No. 3602; oct-3-en-2-ol; (3E)-oct-3-en-2-ol |
| MF |
C8H16O |
| Molecuulgewicht |
128.212 |
| InChI |
InChI=1/C8H16O/c1-3-4-5-6-7-8(2)9/h6-9H,3-5H2,1-2H3/b7-6+ |
| CAS-nummer |
76649-14-4 |
| EINECS |
278-508-9 |
| Moleculaire Structuur |
|
| Dichtheid |
0.843g/cm3 |
| Kookpunt |
178.8°C at 760 mmHg |
| Brekingsindex |
1.447 |
| Vlampunt |
63.4°C |
| Dampdruk |
0.291mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
