77-79-2 Butadiene sulfone
Naam product |
Butadiene sulfone |
Engelse naam |
Butadiene sulfone; 2,5-Dihydrothiophene-1,1-dioxide; 3-Sulfolene; Dihydrothiophene-1,1-dioxide; Butadiene sulphone; Cyclobutenesulfone |
MF |
C4H6O2S |
Molecuulgewicht |
118.15 |
InChI |
InChI=1/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
CAS-nummer |
77-79-2 |
EINECS |
201-059-7 |
Moleculaire Structuur |
|
Dichtheid |
1.314 |
Smeltpunt |
63-66℃ |
Vlampunt |
112℃ |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|