ChemNet > CAS > 7756-94-7 Triisobutylene (mixture of branched chain isomer)
7756-94-7 Triisobutylene (mixture of branched chain isomer)
Naam product |
Triisobutylene (mixture of branched chain isomer) |
Engelse naam |
Triisobutylene (mixture of branched chain isomer); 1-Propene, 2-methyl-, trimer; Triisobutylene; Triisobutylene [UN2324] [Flammable liquid]; UN2324; tert-butyl |
MF |
C4H9 |
Molecuulgewicht |
57.1143 |
InChI |
InChI=1/C4H9/c1-4(2)3/h1-3H3 |
CAS-nummer |
7756-94-7 |
Moleculaire Structuur |
|
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|