784-04-3 9-Acetylanthracene
Naam product |
9-Acetylanthracene |
Engelse naam |
9-Acetylanthracene; 9-Anthryl methyl ketone; 1-(anthracen-9-yl)ethanone |
MF |
C16H12O |
Molecuulgewicht |
220.2659 |
InChI |
InChI=1/C16H12O/c1-11(17)16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16/h2-10H,1H3 |
CAS-nummer |
784-04-3 |
EINECS |
212-315-2 |
Moleculaire Structuur |
|
Dichtheid |
1.164g/cm3 |
Smeltpunt |
72-76℃ |
Kookpunt |
405.9°C at 760 mmHg |
Brekingsindex |
1.685 |
Vlampunt |
180.7°C |
Dampdruk |
8.47E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|