ChemNet > CAS > 78985-13-4 2,3,5,6-Tetramethylbenzyl alcohol
78985-13-4 2,3,5,6-Tetramethylbenzyl alcohol
Naam product |
2,3,5,6-Tetramethylbenzyl alcohol |
Engelse naam |
2,3,5,6-Tetramethylbenzyl alcohol;(2,3,5,6-tetramethylphenyl)methanol |
MF |
C11H16O |
Molecuulgewicht |
164.2441 |
InChI |
InChI=1/C11H16O/c1-7-5-8(2)10(4)11(6-12)9(7)3/h5,12H,6H2,1-4H3 |
CAS-nummer |
78985-13-4 |
Moleculaire Structuur |
|
Dichtheid |
0.975g/cm3 |
Kookpunt |
245.2°C at 760 mmHg |
Brekingsindex |
1.53 |
Vlampunt |
110.7°C |
Dampdruk |
0.0155mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|