ChemNet > CAS > 777-84-4;79328-69-1 4-Nitrophenyl chloroacetate
777-84-4;79328-69-1 4-Nitrophenyl chloroacetate
| Naam product |
4-Nitrophenyl chloroacetate |
| Engelse naam |
4-Nitrophenyl chloroacetate; AI3-23373; Acetic acid, chloro-, 4-nitrophenyl ester |
| MF |
C8H6ClNO4 |
| Molecuulgewicht |
215.5905 |
| InChI |
InChI=1/C8H6ClNO4/c9-5-8(11)14-7-3-1-6(2-4-7)10(12)13/h1-4H,5H2 |
| CAS-nummer |
777-84-4;79328-69-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.434g/cm3 |
| Smeltpunt |
73-75℃ |
| Kookpunt |
334.5°C at 760 mmHg |
| Brekingsindex |
1.565 |
| Vlampunt |
156.1°C |
| Dampdruk |
0.000128mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
