ChemNet > CAS > 79676-56-5 2-(Difluoromethylthio)benzoic acid
79676-56-5 2-(Difluoromethylthio)benzoic acid
Naam product |
2-(Difluoromethylthio)benzoic acid |
Engelse naam |
2-(Difluoromethylthio)benzoic acid;2-[(difluoromethyl)sulfanyl]benzoate; 2-[(difluoromethyl)sulfanyl]benzoic acid; 2-[(difluoromethyl)sulfanyl]benzoyl chloride |
MF |
C8H5ClF2OS |
Molecuulgewicht |
222.6395 |
InChI |
InChI=1/C8H5ClF2OS/c9-7(12)5-3-1-2-4-6(5)13-8(10)11/h1-4,8H |
CAS-nummer |
79676-56-5 |
Moleculaire Structuur |
|
Dichtheid |
1.42g/cm3 |
Kookpunt |
236.2°C at 760 mmHg |
Brekingsindex |
1.541 |
Vlampunt |
96.6°C |
Dampdruk |
0.0481mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|