ChemNet > CAS > 80789-69-1 1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid
80789-69-1 1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid
Naam product |
1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid |
Engelse naam |
1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid;1-(4-Chlorophenyl)cyclopentanecarboxylic acid; 1-(4-chlorophenyl)cyclopentanecarboxylate |
MF |
C12H12ClO2 |
Molecuulgewicht |
223.676 |
InChI |
InChI=1/C12H13ClO2/c13-10-5-3-9(4-6-10)12(11(14)15)7-1-2-8-12/h3-6H,1-2,7-8H2,(H,14,15)/p-1 |
CAS-nummer |
80789-69-1 |
EINECS |
279-552-1 |
Moleculaire Structuur |
|
Smeltpunt |
160-164℃ |
Kookpunt |
364.6°C at 760 mmHg |
Vlampunt |
174.3°C |
Dampdruk |
5.9E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|