ChemNet > CAS > 80866-80-4 2-Chloro-5-nitrobenzyl alcohol
80866-80-4 2-Chloro-5-nitrobenzyl alcohol
Naam product |
2-Chloro-5-nitrobenzyl alcohol |
Engelse naam |
2-Chloro-5-nitrobenzyl alcohol;(2-chloro-5-nitrophenyl)methanol |
MF |
C7H6ClNO3 |
Molecuulgewicht |
187.5804 |
InChI |
InChI=1/C7H6ClNO3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-3,10H,4H2 |
CAS-nummer |
80866-80-4 |
EINECS |
279-584-6 |
Moleculaire Structuur |
|
Dichtheid |
1.476g/cm3 |
Smeltpunt |
74-79℃ |
Kookpunt |
344.1°C at 760 mmHg |
Brekingsindex |
1.611 |
Vlampunt |
161.9°C |
Dampdruk |
2.56E-05mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|