ChemNet > CAS > 81029-03-0 2,3-Dimethyl-p-nitroanisole
81029-03-0 2,3-Dimethyl-p-nitroanisole
Naam product |
2,3-Dimethyl-p-nitroanisole |
Engelse naam |
2,3-Dimethyl-p-nitroanisole; 2,3-Dimethyl-4-nitroanisole; 1-methoxy-2,3-dimethyl-4-nitrobenzene |
MF |
C9H11NO3 |
Molecuulgewicht |
181.1885 |
InChI |
InChI=1/C9H11NO3/c1-6-7(2)9(13-3)5-4-8(6)10(11)12/h4-5H,1-3H3 |
CAS-nummer |
81029-03-0 |
EINECS |
279-674-5 |
Moleculaire Structuur |
|
Dichtheid |
1.148g/cm3 |
Smeltpunt |
70-73℃ |
Kookpunt |
303.2°C at 760 mmHg |
Brekingsindex |
1.534 |
Vlampunt |
141.2°C |
Dampdruk |
0.0017mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|