ChemNet > CAS > 813-56-9 Malonisch-d2-zuur-d2
813-56-9 Malonisch-d2-zuur-d2
| Naam product |
Malonisch-d2-zuur-d2 |
| Synoniemen |
Malonzuur-d4; (~2~H_2_)propaan(~2~H_2_)dioïnezuur |
| Engelse naam |
Malonic-d2 acid-d2; Malonic acid-d4; (~2~H_2_)propane(~2~H_2_)dioic acid |
| MF |
C3D4O4 |
| Molecuulgewicht |
108.0861 |
| InChI |
InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
| CAS-nummer |
813-56-9 |
| EINECS |
212-385-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.605g/cm3 |
| Smeltpunt |
130-132℃ |
| Kookpunt |
386.8°C at 760 mmHg |
| Brekingsindex |
1.478 |
| Vlampunt |
201.9°C |
| Dampdruk |
4.66E-07mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
