ChemNet > CAS > 81452-54-2 Methyl 3-methylthiophene-2-carboxylate
81452-54-2 Methyl 3-methylthiophene-2-carboxylate
Naam product |
Methyl 3-methylthiophene-2-carboxylate |
Engelse naam |
Methyl 3-methylthiophene-2-carboxylate; 3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
MF |
C7H8O2S |
Molecuulgewicht |
156.2022 |
InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
CAS-nummer |
81452-54-2 |
Moleculaire Structuur |
|
Dichtheid |
1.173g/cm3 |
Kookpunt |
211°C at 760 mmHg |
Brekingsindex |
1.531 |
Vlampunt |
81.4°C |
Dampdruk |
0.186mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|