ChemNet > CAS > 818-38-2 diethyl glutarate
818-38-2 diethyl glutarate
| Naam product |
diethyl glutarate |
| Engelse naam |
diethyl glutarate; Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
| MF |
C9H16O4 |
| Molecuulgewicht |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
| CAS-nummer |
818-38-2 |
| EINECS |
212-451-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.022g/cm3 |
| Kookpunt |
236.5°C at 760 mmHg |
| Brekingsindex |
1.427 |
| Vlampunt |
96.1°C |
| Dampdruk |
0.0472mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
