818-88-2 mono-methyl sebacate
Naam product |
mono-methyl sebacate |
Engelse naam |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
MF |
C11H20O4 |
Molecuulgewicht |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
CAS-nummer |
818-88-2 |
EINECS |
212-458-0 |
Moleculaire Structuur |
|
Dichtheid |
1.038g/cm3 |
Smeltpunt |
41-44℃ |
Kookpunt |
332.5°C at 760 mmHg |
Brekingsindex |
1.453 |
Vlampunt |
115.4°C |
Dampdruk |
2.8E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|