ChemNet > CAS > 82191-17-1 ethyl-2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazine-2-yl)acetaat
82191-17-1 ethyl-2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazine-2-yl)acetaat
Naam product |
ethyl-2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazine-2-yl)acetaat |
Synoniemen |
ethyl (3-oxo-3,4-dihydro-2H-1,4-benzothiazine-2-yl)acetaat |
Engelse naam |
ethyl 2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate;ethyl (3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate |
MF |
C12H13NO3S |
Molecuulgewicht |
251.3015 |
InChI |
InChI=1/C12H13NO3S/c1-2-16-11(14)7-10-12(15)13-8-5-3-4-6-9(8)17-10/h3-6,10H,2,7H2,1H3,(H,13,15) |
CAS-nummer |
82191-17-1 |
Moleculaire Structuur |
|
Dichtheid |
1.241g/cm3 |
Smeltpunt |
126℃ |
Kookpunt |
419°C at 760 mmHg |
Brekingsindex |
1.564 |
Vlampunt |
207.2°C |
Dampdruk |
3.13E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|