ChemNet > CAS > 822-86-6 trans-1,2-Dichlorocyclohexane
822-86-6 trans-1,2-Dichlorocyclohexane
Naam product |
trans-1,2-Dichlorocyclohexane |
Engelse naam |
trans-1,2-Dichlorocyclohexane; Dychlorocyclohexane; trans-1,2-Dychlorocyclohexane; 1,2-dichlorocyclohexane; (1R,2R)-1,2-dichlorocyclohexane; (1R)-1,2-dichlorocyclohexane |
MF |
C6H10Cl2 |
Molecuulgewicht |
153.0496 |
InChI |
InChI=1/C6H10Cl2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6?/m1/s1 |
CAS-nummer |
822-86-6 |
EINECS |
212-503-4 |
Moleculaire Structuur |
|
Dichtheid |
1.14g/cm3 |
Kookpunt |
198°C at 760 mmHg |
Brekingsindex |
1.472 |
Vlampunt |
66.1°C |
Dampdruk |
0.518mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|