ChemNet > CAS > 825-44-5 Thianaphthene-1,1-dioxide
825-44-5 Thianaphthene-1,1-dioxide
Naam product |
Thianaphthene-1,1-dioxide |
Engelse naam |
Thianaphthene-1,1-dioxide; Thianaphthene 1,1-dioxide; Benzo[b]thiophene 1,1-dioxide; 1-benzothiophene 1,1-dioxide |
MF |
C8H6O2S |
Molecuulgewicht |
166.197 |
InChI |
InChI=1/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
CAS-nummer |
825-44-5 |
EINECS |
212-544-8 |
Moleculaire Structuur |
|
Dichtheid |
1.403g/cm3 |
Smeltpunt |
137-138℃ |
Kookpunt |
371.1°C at 760 mmHg |
Brekingsindex |
1.64 |
Vlampunt |
244°C |
Dampdruk |
2.25E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|