827-15-6 iodopentafluorobenzene
Naam product |
iodopentafluorobenzene |
Engelse naam |
iodopentafluorobenzene; Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene; 1-Iodo-2,3,4,5,6-Pentafluorobenzene |
MF |
C6F5I |
Molecuulgewicht |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
CAS-nummer |
827-15-6 |
EINECS |
212-565-2 |
Moleculaire Structuur |
|
Dichtheid |
2.217g/cm3 |
Kookpunt |
166.7°C at 760 mmHg |
Brekingsindex |
1.502 |
Vlampunt |
61.3°C |
Dampdruk |
2.33mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|