ChemNet > CAS > 827-88-3 alpha-Cyclopropyl-4-fluorobenzyl alcohol
827-88-3 alpha-Cyclopropyl-4-fluorobenzyl alcohol
Naam product |
alpha-Cyclopropyl-4-fluorobenzyl alcohol |
Engelse naam |
alpha-Cyclopropyl-4-fluorobenzyl alcohol; Cyclopropyl(4-fluorophenyl)methanol; (R)-cyclopropyl(4-fluorophenyl)methanol; (S)-cyclopropyl(4-fluorophenyl)methanol |
MF |
C10H11FO |
Molecuulgewicht |
166.1921 |
InChI |
InChI=1/C10H11FO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7,10,12H,1-2H2/t10-/m0/s1 |
CAS-nummer |
827-88-3 |
EINECS |
212-576-2 |
Moleculaire Structuur |
|
Dichtheid |
1.24g/cm3 |
Kookpunt |
250.8°C at 760 mmHg |
Brekingsindex |
1.578 |
Vlampunt |
128.9°C |
Dampdruk |
0.0111mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|