830-03-5 4-Nitrophenyl acetate
Naam product |
4-Nitrophenyl acetate |
Engelse naam |
4-Nitrophenyl acetate; Acetic acid 4-nitrophenyl ester; p-Nitrophenol acetate |
MF |
C8H7NO4 |
Molecuulgewicht |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
CAS-nummer |
830-03-5 |
EINECS |
212-593-5 |
Moleculaire Structuur |
|
Dichtheid |
1.304g/cm3 |
Smeltpunt |
76-79℃ |
Kookpunt |
296.8°C at 760 mmHg |
Brekingsindex |
1.548 |
Vlampunt |
145.2°C |
Dampdruk |
0.0014mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|