831-91-4 Benzyl phenyl sulfide
Naam product |
Benzyl phenyl sulfide |
Engelse naam |
Benzyl phenyl sulfide; Benzyl phenyl sulphide; Benzyl phenyl sylphide; (benzylsulfanyl)benzene |
MF |
C13H12S |
Molecuulgewicht |
200.2994 |
InChI |
InChI=1/C13H12S/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13/h1-10H,11H2 |
CAS-nummer |
831-91-4 |
EINECS |
212-612-7 |
Moleculaire Structuur |
|
Dichtheid |
1.1g/cm3 |
Smeltpunt |
40-43℃ |
Kookpunt |
321.1°C at 760 mmHg |
Brekingsindex |
1.626 |
Vlampunt |
138.9°C |
Dampdruk |
0.000572mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|