ChemNet > CAS > 838-57-3 Ethyl 4-nitrobenzoylacetate
838-57-3 Ethyl 4-nitrobenzoylacetate
Naam product |
Ethyl 4-nitrobenzoylacetate |
Engelse naam |
Ethyl 4-nitrobenzoylacetate; Ethyl (p-nitrobenzoyl)acetate; (4-Nitrobenzoyl)acetic acid ethyl ester; (p-Nitrobenzoyl)acetic acid ethyl ester; 4-10-00-02759 (Beilstein Handbook Reference); Acetic acid, (p-nitrobenzoyl)-, ethyl ester; BRN 1124763; Ethyl (4-nitrobenzoyl)acetate; Ethyl 4-nitro-beta-oxobenzenepropanoate; NSC 62134; Benzenepropanoic acid, 4-nitro-beta-oxo-, ethyl ester; ethyl 3-(4-nitrophenyl)-3-oxopropanoate |
MF |
C11H11NO5 |
Molecuulgewicht |
237.2087 |
InChI |
InChI=1/C11H11NO5/c1-2-17-11(14)7-10(13)8-3-5-9(6-4-8)12(15)16/h3-6H,2,7H2,1H3 |
CAS-nummer |
838-57-3 |
EINECS |
212-656-7 |
Moleculaire Structuur |
|
Dichtheid |
1.276g/cm3 |
Smeltpunt |
67-71℃ |
Kookpunt |
344.7°C at 760 mmHg |
Brekingsindex |
1.542 |
Vlampunt |
149.6°C |
Dampdruk |
6.49E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|