ChemNet > CAS > 84604-70-6 1-(2,4-Dichlorophenyl)cyclopropanecarboxylic acid
84604-70-6 1-(2,4-Dichlorophenyl)cyclopropanecarboxylic acid
| Naam product |
1-(2,4-Dichlorophenyl)cyclopropanecarboxylic acid |
| Engelse naam |
1-(2,4-Dichlorophenyl)cyclopropanecarboxylic acid;1-(2,4-dichlorophenyl)cyclopropanecarboxylate |
| MF |
C10H7Cl2O2 |
| Molecuulgewicht |
230.0679 |
| InChI |
InChI=1/C10H8Cl2O2/c11-6-1-2-7(8(12)5-6)10(3-4-10)9(13)14/h1-2,5H,3-4H2,(H,13,14)/p-1 |
| CAS-nummer |
84604-70-6 |
| EINECS |
283-353-5 |
| Moleculaire Structuur |
|
| Smeltpunt |
140-147℃ |
| Kookpunt |
369.6°C at 760 mmHg |
| Vlampunt |
177.3°C |
| Dampdruk |
4.08E-06mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
