ChemNet > CAS > 85-02-9 5,6-Benzoquinoline
85-02-9 5,6-Benzoquinoline
| Naam product |
5,6-Benzoquinoline |
| Engelse naam |
5,6-Benzoquinoline; beta-Naphthoquinoline; 1-Azaphenanthrene; Benzo[f]quinoline; Benzoquinoline; benzo(f)quinoline |
| MF |
C13H9N |
| Molecuulgewicht |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
| CAS-nummer |
85-02-9 |
| EINECS |
201-582-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.187g/cm3 |
| Smeltpunt |
89-91℃ |
| Kookpunt |
350.4°C at 760 mmHg |
| Brekingsindex |
1.726 |
| Vlampunt |
155.9°C |
| Dampdruk |
8.89E-05mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
