85-29-0 2,4'-Dichlorobenzophenone
Naam product |
2,4'-Dichlorobenzophenone |
Engelse naam |
2,4'-Dichlorobenzophenone; Dichlorobenzophenone |
MF |
C13H8Cl2O |
Molecuulgewicht |
251.11 |
InChI |
InChI=1/C13H8Cl2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H |
CAS-nummer |
85-29-0 |
EINECS |
201-596-7 |
Moleculaire Structuur |
|
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|