ChemNet > CAS > 85-55-2 2-(4-Methylbenzoyl)benzoic acid
85-55-2 2-(4-Methylbenzoyl)benzoic acid
Naam product |
2-(4-Methylbenzoyl)benzoic acid |
Engelse naam |
2-(4-Methylbenzoyl)benzoic acid; 2-(p-Toluoyl)benzoic acid; 4-Methylbenzophenone-2-carboxylic acid; 2-[(4-methylphenyl)carbonyl]benzoate |
MF |
C15H11O3 |
Molecuulgewicht |
239.2466 |
InChI |
InChI=1/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18)/p-1 |
CAS-nummer |
85-55-2 |
EINECS |
201-614-3 |
Moleculaire Structuur |
|
Smeltpunt |
137-139℃ |
Kookpunt |
457.1°C at 760 mmHg |
Vlampunt |
244.3°C |
Dampdruk |
3.79E-09mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|