ChemNet > CAS > 855-97-0 3',4',5,7-Tetramethoxyflavone
855-97-0 3',4',5,7-Tetramethoxyflavone
Naam product |
3',4',5,7-Tetramethoxyflavone |
Engelse naam |
3',4',5,7-Tetramethoxyflavone; Luteolin tetramethyl ether; 2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4H-chromen-4-one |
MF |
C19H18O6 |
Molecuulgewicht |
342.3426 |
InChI |
InChI=1/C19H18O6/c1-21-12-8-17(24-4)19-13(20)10-15(25-18(19)9-12)11-5-6-14(22-2)16(7-11)23-3/h5-10H,1-4H3 |
CAS-nummer |
855-97-0 |
Moleculaire Structuur |
|
Dichtheid |
1.243g/cm3 |
Kookpunt |
528.8°C at 760 mmHg |
Brekingsindex |
1.574 |
Vlampunt |
233.9°C |
Dampdruk |
2.86E-11mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|