ChemNet > CAS > 86454-13-9 2-hydroxy-6-methylisonicotinic acid
86454-13-9 2-hydroxy-6-methylisonicotinic acid
| Naam product |
2-hydroxy-6-methylisonicotinic acid |
| Engelse naam |
2-hydroxy-6-methylisonicotinic acid; 6-methyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid; 2-Hydroxy-6-Methylpyridine-4-Carboxylic Acid |
| MF |
C7H7NO3 |
| Molecuulgewicht |
153.1354 |
| InChI |
InChI=1/C7H7NO3/c1-4-2-5(7(10)11)3-6(9)8-4/h2-3H,1H3,(H,8,9)(H,10,11) |
| CAS-nummer |
86454-13-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.345g/cm3 |
| Smeltpunt |
330℃ |
| Kookpunt |
371.2°C at 760 mmHg |
| Brekingsindex |
1.555 |
| Vlampunt |
178.3°C |
| Dampdruk |
1.57E-06mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
