ChemNet > CAS > 868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
Naam product |
2-Amino-1-propene-1,1,3-tricarbonitrile |
Engelse naam |
2-Amino-1-propene-1,1,3-tricarbonitrile; 2-aminoprop-1-ene-1,1,3-tricarbonitrile |
MF |
C6H4N4 |
Molecuulgewicht |
132.1228 |
InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
CAS-nummer |
868-54-2 |
EINECS |
212-777-5 |
Moleculaire Structuur |
|
Dichtheid |
1.13g/cm3 |
Smeltpunt |
171-173℃ |
Kookpunt |
454.9°C at 760 mmHg |
Brekingsindex |
1.565 |
Vlampunt |
228.9°C |
Dampdruk |
1.84E-08mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|