87-05-8 7-Ethoxy-4-methylcoumarin
Naam product |
7-Ethoxy-4-methylcoumarin |
Engelse naam |
7-Ethoxy-4-methylcoumarin;7-Ethoxy-4-methyl-2H-chromen-2-one; Ethyl 4-methylumbelliferyl ether |
MF |
C12H12O3 |
Molecuulgewicht |
204.2219 |
InChI |
InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
CAS-nummer |
87-05-8 |
EINECS |
201-721-5 |
Moleculaire Structuur |
|
Dichtheid |
1.163g/cm3 |
Smeltpunt |
113-114℃ |
Kookpunt |
351.4°C at 760 mmHg |
Brekingsindex |
1.548 |
Vlampunt |
146.2°C |
Dampdruk |
4.12E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|