ChemNet > CAS > 87223-76-5 ethyl-2-(2-cyanoanilino)acetaat
87223-76-5 ethyl-2-(2-cyanoanilino)acetaat
| Naam product |
ethyl-2-(2-cyanoanilino)acetaat |
| Synoniemen |
ethyl-N-(2-cyanofenyl)glycinaat |
| Engelse naam |
ethyl 2-(2-cyanoanilino)acetate;ethyl N-(2-cyanophenyl)glycinate |
| MF |
C11H12N2O2 |
| Molecuulgewicht |
204.2252 |
| InChI |
InChI=1/C11H12N2O2/c1-2-15-11(14)8-13-10-6-4-3-5-9(10)7-12/h3-6,13H,2,8H2,1H3 |
| CAS-nummer |
87223-76-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.15g/cm3 |
| Kookpunt |
351.1°C at 760 mmHg |
| Brekingsindex |
1.538 |
| Vlampunt |
166.1°C |
| Dampdruk |
4.2E-05mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
