ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
Naam product |
2-Chloro-6-fluoroacetophenone |
Engelse naam |
2-Chloro-6-fluoroacetophenone;1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
MF |
C8H6ClFO |
Molecuulgewicht |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
CAS-nummer |
87327-69-3 |
Moleculaire Structuur |
|
Dichtheid |
1.258g/cm3 |
Kookpunt |
191.8°C at 760 mmHg |
Brekingsindex |
1.512 |
Vlampunt |
69.8°C |
Dampdruk |
0.506mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/38:Irritating to eyes and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|