877-43-0 2,6-Dimethylquinoline
Naam product |
2,6-Dimethylquinoline |
Engelse naam |
2,6-Dimethylquinoline; 6-METHYLQUINALDINE; 2,6-dimethyl-quinolin; P-TOLUQUINALDINE; Quinoline, 2,6-dimethyl- |
MF |
C11H11N |
Molecuulgewicht |
157.2117 |
InChI |
InChI=1/C11H11N/c1-8-3-6-11-10(7-8)5-4-9(2)12-11/h3-7H,1-2H3 |
CAS-nummer |
877-43-0 |
EINECS |
212-891-5 |
Moleculaire Structuur |
|
Dichtheid |
1.052g/cm3 |
Smeltpunt |
56-60 °C |
Kookpunt |
266.5°C at 760 mmHg |
Brekingsindex |
1.61 |
Vlampunt |
106.5°C |
Dampdruk |
0.0142mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|